C9H10NOY- — CID 59586494
3,4,5,7-tetrahydro-2H-1,4-benzoxazepin-7-ide;yttrium (PubChem CID 59586494) has the molecular formula C9H10NOY- and a molecular weight of 237.09 g/mol. Its IUPAC name is 3,4,5,7-tetrahydro-2H-1,4-benzoxazepin-7-ide;yttrium.
| Compound Name | 3,4,5,7-tetrahydro-2H-1,4-benzoxazepin-7-ide;yttrium |
|---|---|
| PubChem CID | 59586494 |
| Molecular Formula | C9H10NOY- |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | 3,4,5,7-tetrahydro-2H-1,4-benzoxazepin-7-ide;yttrium |
| SMILES | [Y].[c-]1ccc2c(c1)CNCCO2 |
| InChI | InChI=1S/C9H10NO.Y/c1-2-4-9-8(3-1)7-10-5-6-11-9;/h2-4,10H,5-7H2;/q-1; |
| InChIKey | ZVQUEAFJVLQUEU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|