C30H35FN6O — CID 59586537
4-[2-(4-fluorobutyl)-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-yl]-7-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)-3,5-dihydro-2H-1,4-benzoxazepine (PubChem CID 59586537) has the molecular formula C30H35FN6O and a molecular weight of 514.65 g/mol. Its IUPAC name is 4-[2-(4-fluorobutyl)-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-yl]-7-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)-3,5-dihydro-2H-1,4-benzoxazepine.
| Compound Name | 4-[2-(4-fluorobutyl)-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-yl]-7-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)-3,5-dihydro-2H-1,4-benzoxazepine |
|---|---|
| PubChem CID | 59586537 |
| Molecular Formula | C30H35FN6O |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 4-[2-(4-fluorobutyl)-6,6-dimethyl-7,8-dihydro-5H-quinazolin-4-yl]-7-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)-3,5-dihydro-2H-1,4-benzoxazepine |
| SMILES | Cc1nc2ncc(-c3ccc4c(c3)CN(c3nc(CCCCF)nc5c3CC(C)(C)CC5)CCO4)cc2[nH]1 |
| InChI | InChI=1S/C30H35FN6O/c1-19-33-25-15-21(17-32-28(25)34-19)20-7-8-26-22(14-20)18-37(12-13-38-26)29-23-16-30(2,3)10-9-24(23)35-27(36-29)6-4-5-11-31/h7-8,14-15,17H,4-6,9-13,16,18H2,1-3H3,(H,32,33,34) |
| InChIKey | YNDLYIUWJIADPP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|