About N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine
N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine (PubChem CID 59586795) has the molecular formula C8H6Cl2N4O
and a molecular weight of 245.07 g/mol. Its IUPAC name is N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine |
| PubChem CID | 59586795 |
| Molecular Formula | C8H6Cl2N4O |
| Molecular Weight | 245.07 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine |
| SMILES | Cc1cc(Nc2nc(Cl)ncc2Cl)no1 |
| InChI | InChI=1S/C8H6Cl2N4O/c1-4-2-6(14-15-4)12-7-5(9)3-11-8(10)13-7/h2-3H,1H3,(H,11,12,13,14) |
| InChIKey | DZBFDMZCVZXQFK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.07 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine?
The IUPAC name of N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine (CID 59586795) is N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine.
What is the SMILES notation for N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine?
The canonical SMILES for N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine is Cc1cc(Nc2nc(Cl)ncc2Cl)no1.
What is the InChIKey of N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine?
The InChIKey is DZBFDMZCVZXQFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2N4O/c1-4-2-6(14-15-4)12-7-5(9)3-11-8(10)13-7/h2-3H,1H3,(H,11,12,13,14).
What are the key properties of N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine?
N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine has a molecular weight of 245.07 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dichloropyrimidin-4-yl)-5-methyl-1,2-oxazol-3-amine is sourced from PubChem (CID 59586795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).