C29H33F2N3O8 — CID 59587289
[4-[[6-(1,3-difluoropropan-2-yloxy)-1-(1-formylpiperidin-4-yl)-2,4-dioxoquinazolin-3-yl]methyl]-2-methoxyphenyl] propan-2-yl carbonate (PubChem CID 59587289) has the molecular formula C29H33F2N3O8 and a molecular weight of 589.59 g/mol. Its IUPAC name is [4-[[6-(1,3-difluoropropan-2-yloxy)-1-(1-formylpiperidin-4-yl)-2,4-dioxoquinazolin-3-yl]methyl]-2-methoxyphenyl] propan-2-yl carbonate.
| Compound Name | [4-[[6-(1,3-difluoropropan-2-yloxy)-1-(1-formylpiperidin-4-yl)-2,4-dioxoquinazolin-3-yl]methyl]-2-methoxyphenyl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 59587289 |
| Molecular Formula | C29H33F2N3O8 |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | [4-[[6-(1,3-difluoropropan-2-yloxy)-1-(1-formylpiperidin-4-yl)-2,4-dioxoquinazolin-3-yl]methyl]-2-methoxyphenyl] propan-2-yl carbonate |
| SMILES | COc1cc(Cn2c(=O)c3cc(OC(CF)CF)ccc3n(C3CCN(C=O)CC3)c2=O)ccc1OC(=O)OC(C)C |
| InChI | InChI=1S/C29H33F2N3O8/c1-18(2)40-29(38)42-25-7-4-19(12-26(25)39-3)16-33-27(36)23-13-21(41-22(14-30)15-31)5-6-24(23)34(28(33)37)20-8-10-32(17-35)11-9-20/h4-7,12-13,17-18,20,22H,8-11,14-16H2,1-3H3 |
| InChIKey | KHZAJGPLGPMCBV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 118.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|