About 5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile
5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile (PubChem CID 59587450) has the molecular formula C16H10F2N4O
and a molecular weight of 312.28 g/mol. Its IUPAC name is 5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile |
| PubChem CID | 59587450 |
| Molecular Formula | C16H10F2N4O |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(-c2c(F)cccc2F)oc1Nc1ccc(N)cc1 |
| InChI | InChI=1S/C16H10F2N4O/c17-11-2-1-3-12(18)14(11)16-22-13(8-19)15(23-16)21-10-6-4-9(20)5-7-10/h1-7,21H,20H2 |
| InChIKey | DREFHYCOIYVALT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile?
The IUPAC name of 5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile (CID 59587450) is 5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile is N#Cc1nc(-c2c(F)cccc2F)oc1Nc1ccc(N)cc1.
What is the InChIKey of 5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile?
The InChIKey is DREFHYCOIYVALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F2N4O/c17-11-2-1-3-12(18)14(11)16-22-13(8-19)15(23-16)21-10-6-4-9(20)5-7-10/h1-7,21H,20H2.
What are the key properties of 5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile?
5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile has a molecular weight of 312.28 g/mol, XLogP of 3.82, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-aminoanilino)-2-(2,6-difluorophenyl)-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 59587450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).