C20H18F2N4O4 — CID 59587486
2-(2,6-difluorophenyl)-5-[4-(3-hydroxypropylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide (PubChem CID 59587486) has the molecular formula C20H18F2N4O4 and a molecular weight of 416.38 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-5-[4-(3-hydroxypropylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2,6-difluorophenyl)-5-[4-(3-hydroxypropylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 59587486 |
| Molecular Formula | C20H18F2N4O4 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-(2,6-difluorophenyl)-5-[4-(3-hydroxypropylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1nc(-c2c(F)cccc2F)oc1Nc1ccc(C(=O)NCCCO)cc1 |
| InChI | InChI=1S/C20H18F2N4O4/c21-13-3-1-4-14(22)15(13)19-26-16(17(23)28)20(30-19)25-12-7-5-11(6-8-12)18(29)24-9-2-10-27/h1,3-8,25,27H,2,9-10H2,(H2,23,28)(H,24,29) |
| InChIKey | HLLHUBLRZHHTBY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|