C21H21F2N5O3 — CID 59587544
2-(2,6-difluorophenyl)-5-[4-[3-(methylamino)propylcarbamoyl]anilino]-1,3-oxazole-4-carboxamide (PubChem CID 59587544) has the molecular formula C21H21F2N5O3 and a molecular weight of 429.43 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-5-[4-[3-(methylamino)propylcarbamoyl]anilino]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2,6-difluorophenyl)-5-[4-[3-(methylamino)propylcarbamoyl]anilino]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 59587544 |
| Molecular Formula | C21H21F2N5O3 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-(2,6-difluorophenyl)-5-[4-[3-(methylamino)propylcarbamoyl]anilino]-1,3-oxazole-4-carboxamide |
| SMILES | CNCCCNC(=O)c1ccc(Nc2oc(-c3c(F)cccc3F)nc2C(N)=O)cc1 |
| InChI | InChI=1S/C21H21F2N5O3/c1-25-10-3-11-26-19(30)12-6-8-13(9-7-12)27-21-17(18(24)29)28-20(31-21)16-14(22)4-2-5-15(16)23/h2,4-9,25,27H,3,10-11H2,1H3,(H2,24,29)(H,26,30) |
| InChIKey | UTZQWHGZDIYHOH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|