About 2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide
2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide (PubChem CID 59587619) has the molecular formula C19H16F2N4O3
and a molecular weight of 386.36 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide |
| PubChem CID | 59587619 |
| Molecular Formula | C19H16F2N4O3 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(Nc2oc(-c3c(F)cccc3F)nc2C(N)=O)cc1 |
| InChI | InChI=1S/C19H16F2N4O3/c1-25(2)19(27)10-6-8-11(9-7-10)23-18-15(16(22)26)24-17(28-18)14-12(20)4-3-5-13(14)21/h3-9,23H,1-2H3,(H2,22,26) |
| InChIKey | ZDPJKNQCCAKNEI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide (CID 59587619) is 2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide is CN(C)C(=O)c1ccc(Nc2oc(-c3c(F)cccc3F)nc2C(N)=O)cc1.
What is the InChIKey of 2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide?
The InChIKey is ZDPJKNQCCAKNEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2N4O3/c1-25(2)19(27)10-6-8-11(9-7-10)23-18-15(16(22)26)24-17(28-18)14-12(20)4-3-5-13(14)21/h3-9,23H,1-2H3,(H2,22,26).
What are the key properties of 2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide?
2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide has a molecular weight of 386.36 g/mol, XLogP of 3.16, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-5-[4-(dimethylcarbamoyl)anilino]-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 59587619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).