About N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine
N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine (PubChem CID 59587727) has the molecular formula C18H12FN7
and a molecular weight of 345.34 g/mol. Its IUPAC name is N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine.
Molecular Properties
| Compound Name | N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine |
| PubChem CID | 59587727 |
| Molecular Formula | C18H12FN7 |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine |
| SMILES | Fc1cccc(Nc2nc3cc(-c4nn[nH]n4)ccc3n3cccc23)c1 |
| InChI | InChI=1S/C18H12FN7/c19-12-3-1-4-13(10-12)20-18-16-5-2-8-26(16)15-7-6-11(9-14(15)21-18)17-22-24-25-23-17/h1-10H,(H,20,21)(H,22,23,24,25) |
| InChIKey | YORZOWQONOESHO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine?
The IUPAC name of N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine (CID 59587727) is N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine.
What is the SMILES notation for N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine?
The canonical SMILES for N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine is Fc1cccc(Nc2nc3cc(-c4nn[nH]n4)ccc3n3cccc23)c1.
What is the InChIKey of N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine?
The InChIKey is YORZOWQONOESHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12FN7/c19-12-3-1-4-13(10-12)20-18-16-5-2-8-26(16)15-7-6-11(9-14(15)21-18)17-22-24-25-23-17/h1-10H,(H,20,21)(H,22,23,24,25).
What are the key properties of N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine?
N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine has a molecular weight of 345.34 g/mol, XLogP of 3.55, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorophenyl)-7-(2H-tetrazol-5-yl)pyrrolo[1,2-a]quinoxalin-4-amine is sourced from PubChem (CID 59587727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).