C17H13ClFN3O2S — CID 59588218
N-(3-chloro-2-fluorophenyl)-4-(4-methylsulfonylphenyl)pyrimidin-2-amine (PubChem CID 59588218) has the molecular formula C17H13ClFN3O2S and a molecular weight of 377.83 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-4-(4-methylsulfonylphenyl)pyrimidin-2-amine.
| Compound Name | N-(3-chloro-2-fluorophenyl)-4-(4-methylsulfonylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 59588218 |
| Molecular Formula | C17H13ClFN3O2S |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-4-(4-methylsulfonylphenyl)pyrimidin-2-amine |
| SMILES | CS(=O)(=O)c1ccc(-c2ccnc(Nc3cccc(Cl)c3F)n2)cc1 |
| InChI | InChI=1S/C17H13ClFN3O2S/c1-25(23,24)12-7-5-11(6-8-12)14-9-10-20-17(21-14)22-15-4-2-3-13(18)16(15)19/h2-10H,1H3,(H,20,21,22) |
| InChIKey | MNSCYYZFIISMFC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |