About 4-(5-bromo-2,3-difluorophenyl)morpholine
4-(5-bromo-2,3-difluorophenyl)morpholine (PubChem CID 59588253) has the molecular formula C10H10BrF2NO
and a molecular weight of 278.10 g/mol. Its IUPAC name is 4-(5-bromo-2,3-difluorophenyl)morpholine.
Molecular Properties
| Compound Name | 4-(5-bromo-2,3-difluorophenyl)morpholine |
| PubChem CID | 59588253 |
| Molecular Formula | C10H10BrF2NO |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 4-(5-bromo-2,3-difluorophenyl)morpholine |
| SMILES | Fc1cc(Br)cc(N2CCOCC2)c1F |
| InChI | InChI=1S/C10H10BrF2NO/c11-7-5-8(12)10(13)9(6-7)14-1-3-15-4-2-14/h5-6H,1-4H2 |
| InChIKey | TUYFFDACBXICHR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-bromo-2,3-difluorophenyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-2,3-difluorophenyl)morpholine?
The IUPAC name of 4-(5-bromo-2,3-difluorophenyl)morpholine (CID 59588253) is 4-(5-bromo-2,3-difluorophenyl)morpholine.
What is the SMILES notation for 4-(5-bromo-2,3-difluorophenyl)morpholine?
The canonical SMILES for 4-(5-bromo-2,3-difluorophenyl)morpholine is Fc1cc(Br)cc(N2CCOCC2)c1F.
What is the InChIKey of 4-(5-bromo-2,3-difluorophenyl)morpholine?
The InChIKey is TUYFFDACBXICHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrF2NO/c11-7-5-8(12)10(13)9(6-7)14-1-3-15-4-2-14/h5-6H,1-4H2.
What are the key properties of 4-(5-bromo-2,3-difluorophenyl)morpholine?
4-(5-bromo-2,3-difluorophenyl)morpholine has a molecular weight of 278.10 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-2,3-difluorophenyl)morpholine is sourced from PubChem (CID 59588253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).