C26H27N7O3S2 — CID 59588491
8-N-[(2-amino-[1,3]thiazolo[4,5-b]pyridin-6-yl)methyl]-3-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-thiophen-3-ylimidazo[1,2-a]pyridine-3,8-dicarboxamide (PubChem CID 59588491) has the molecular formula C26H27N7O3S2 and a molecular weight of 549.68 g/mol. Its IUPAC name is 8-N-[(2-amino-[1,3]thiazolo[4,5-b]pyridin-6-yl)methyl]-3-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-thiophen-3-ylimidazo[1,2-a]pyridine-3,8-dicarboxamide.
| Compound Name | 8-N-[(2-amino-[1,3]thiazolo[4,5-b]pyridin-6-yl)methyl]-3-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-thiophen-3-ylimidazo[1,2-a]pyridine-3,8-dicarboxamide |
|---|---|
| PubChem CID | 59588491 |
| Molecular Formula | C26H27N7O3S2 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 8-N-[(2-amino-[1,3]thiazolo[4,5-b]pyridin-6-yl)methyl]-3-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-thiophen-3-ylimidazo[1,2-a]pyridine-3,8-dicarboxamide |
| SMILES | CC(C)C[C@@H](CO)NC(=O)c1c(-c2ccsc2)nc2c(C(=O)NCc3cnc4nc(N)sc4c3)cccn12 |
| InChI | InChI=1S/C26H27N7O3S2/c1-14(2)8-17(12-34)30-25(36)21-20(16-5-7-37-13-16)31-23-18(4-3-6-33(21)23)24(35)29-11-15-9-19-22(28-10-15)32-26(27)38-19/h3-7,9-10,13-14,17,34H,8,11-12H2,1-2H3,(H,29,35)(H,30,36)(H2,27,28,32)/t17-/m0/s1 |
| InChIKey | WDPLWTFFMPGDJJ-KRWDZBQOSA-N |
| XLogP | 3.72 |
| TPSA | 147.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |