About 5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine
5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine (PubChem CID 59589158) has the molecular formula C8H9N3S
and a molecular weight of 179.25 g/mol. Its IUPAC name is 5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine |
| PubChem CID | 59589158 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine |
| SMILES | CC(C)c1ncc2ncsc2n1 |
| InChI | InChI=1S/C8H9N3S/c1-5(2)7-9-3-6-8(11-7)12-4-10-6/h3-5H,1-2H3 |
| InChIKey | ROQALTRIXZJMAG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine?
The IUPAC name of 5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine (CID 59589158) is 5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine.
What is the SMILES notation for 5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine?
The canonical SMILES for 5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine is CC(C)c1ncc2ncsc2n1.
What is the InChIKey of 5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine?
The InChIKey is ROQALTRIXZJMAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S/c1-5(2)7-9-3-6-8(11-7)12-4-10-6/h3-5H,1-2H3.
What are the key properties of 5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine?
5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine has a molecular weight of 179.25 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidine is sourced from PubChem (CID 59589158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).