C27H31N5O2 — CID 59589643
N-[4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 59589643) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-[4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 59589643 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | N-[4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1ccc(Cc2nc3cccc(-c4ccc5c(c4)OCCO5)n3n2)cc1 |
| InChI | InChI=1S/C27H31N5O2/c1-3-31(4-2)15-14-28-22-11-8-20(9-12-22)18-26-29-27-7-5-6-23(32(27)30-26)21-10-13-24-25(19-21)34-17-16-33-24/h5-13,19,28H,3-4,14-18H2,1-2H3 |
| InChIKey | LLVAWOXTNCOGJB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |