C28H31N5O3 — CID 59589752
3-(diethylamino)-N-[3-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenyl]propanamide (PubChem CID 59589752) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is 3-(diethylamino)-N-[3-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenyl]propanamide.
| Compound Name | 3-(diethylamino)-N-[3-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 59589752 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 3-(diethylamino)-N-[3-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenyl]propanamide |
| SMILES | CCN(CC)CCC(=O)Nc1cccc(Cc2nc3cccc(-c4ccc5c(c4)OCCO5)n3n2)c1 |
| InChI | InChI=1S/C28H31N5O3/c1-3-32(4-2)14-13-28(34)29-22-8-5-7-20(17-22)18-26-30-27-10-6-9-23(33(27)31-26)21-11-12-24-25(19-21)36-16-15-35-24/h5-12,17,19H,3-4,13-16,18H2,1-2H3,(H,29,34) |
| InChIKey | RHEOCCDTERGBID-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |