C24H25N5O — CID 59589885
5-(4-methoxyphenyl)-2-[(4-piperazin-1-ylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 59589885) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-[(4-piperazin-1-ylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-(4-methoxyphenyl)-2-[(4-piperazin-1-ylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 59589885 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-[(4-piperazin-1-ylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1ccc(-c2cccc3nc(Cc4ccc(N5CCNCC5)cc4)nn23)cc1 |
| InChI | InChI=1S/C24H25N5O/c1-30-21-11-7-19(8-12-21)22-3-2-4-24-26-23(27-29(22)24)17-18-5-9-20(10-6-18)28-15-13-25-14-16-28/h2-12,25H,13-17H2,1H3 |
| InChIKey | JSHAJSCLBUBATI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|