C25H25N5O2 — CID 59589907
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(4-piperazin-1-ylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 59589907) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(4-piperazin-1-ylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(4-piperazin-1-ylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 59589907 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(4-piperazin-1-ylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | c1cc(-c2ccc3c(c2)OCCO3)n2nc(Cc3ccc(N4CCNCC4)cc3)nc2c1 |
| InChI | InChI=1S/C25H25N5O2/c1-2-21(19-6-9-22-23(17-19)32-15-14-31-22)30-25(3-1)27-24(28-30)16-18-4-7-20(8-5-18)29-12-10-26-11-13-29/h1-9,17,26H,10-16H2 |
| InChIKey | HAYHEYHANXFTOY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|