C27H34N6O — CID 59589944
5-(1-pentylpyrazol-4-yl)-2-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 59589944) has the molecular formula C27H34N6O and a molecular weight of 458.61 g/mol. Its IUPAC name is 5-(1-pentylpyrazol-4-yl)-2-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-(1-pentylpyrazol-4-yl)-2-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 59589944 |
| Molecular Formula | C27H34N6O |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 5-(1-pentylpyrazol-4-yl)-2-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CCCCCn1cc(-c2cccc3nc(Cc4ccc(OCCN5CCCC5)cc4)nn23)cn1 |
| InChI | InChI=1S/C27H34N6O/c1-2-3-4-16-32-21-23(20-28-32)25-8-7-9-27-29-26(30-33(25)27)19-22-10-12-24(13-11-22)34-18-17-31-14-5-6-15-31/h7-13,20-21H,2-6,14-19H2,1H3 |
| InChIKey | DUEVKMOXBNNPES-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 60.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|