C9H20O2 — CID 59590927
(3S)-2,2,4,4-tetramethylpentane-1,3-diol (PubChem CID 59590927) has the molecular formula C9H20O2 and a molecular weight of 160.26 g/mol. Its IUPAC name is (3S)-2,2,4,4-tetramethylpentane-1,3-diol.
| Compound Name | (3S)-2,2,4,4-tetramethylpentane-1,3-diol |
|---|---|
| PubChem CID | 59590927 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | (3S)-2,2,4,4-tetramethylpentane-1,3-diol |
| SMILES | CC(C)(C)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C9H20O2/c1-8(2,3)7(11)9(4,5)6-10/h7,10-11H,6H2,1-5H3/t7-/m0/s1 |
| InChIKey | OQGLREGMROLUAQ-ZETCQYMHSA-N |
| XLogP | 1.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |