About carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+)
carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+) (PubChem CID 59590991) has the molecular formula C15H22NY
and a molecular weight of 305.25 g/mol. Its IUPAC name is carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+).
Molecular Properties
| Compound Name | carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+) |
| PubChem CID | 59590991 |
| Molecular Formula | C15H22NY |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+) |
| SMILES | [CH2-]CC1(C[CH2-])CC(CC)c2ccncc21.[CH3-].[Y+3] |
| InChI | InChI=1S/C14H19N.CH3.Y/c1-4-11-9-14(5-2,6-3)13-10-15-8-7-12(11)13;;/h7-8,10-11H,2-6,9H2,1H3;1H3;/q-2;-1;+3 |
| InChIKey | MWHDAOSYTOXGQJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+)?
The IUPAC name of carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+) (CID 59590991) is carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+).
What is the SMILES notation for carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+)?
The canonical SMILES for carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+) is [CH2-]CC1(C[CH2-])CC(CC)c2ccncc21.[CH3-].[Y+3].
What is the InChIKey of carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+)?
The InChIKey is MWHDAOSYTOXGQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N.CH3.Y/c1-4-11-9-14(5-2,6-3)13-10-15-8-7-12(11)13;;/h7-8,10-11H,2-6,9H2,1H3;1H3;/q-2;-1;+3.
What are the key properties of carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+)?
carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+) has a molecular weight of 305.25 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;5-ethyl-7,7-di(ethyl)-5,6-dihydrocyclopenta[c]pyridine;yttrium(3+) is sourced from PubChem (CID 59590991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).