About 1-but-1-en-2-ylaziridine
1-but-1-en-2-ylaziridine (PubChem CID 59591112) has the molecular formula C6H11N
and a molecular weight of 97.16 g/mol. Its IUPAC name is 1-but-1-en-2-ylaziridine.
Molecular Properties
| Compound Name | 1-but-1-en-2-ylaziridine |
| PubChem CID | 59591112 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | 1-but-1-en-2-ylaziridine |
| SMILES | C=C(CC)N1CC1 |
| InChI | InChI=1S/C6H11N/c1-3-6(2)7-4-5-7/h2-5H2,1H3 |
| InChIKey | NFRWSXLFCOUFDF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-but-1-en-2-ylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-1-en-2-ylaziridine?
The IUPAC name of 1-but-1-en-2-ylaziridine (CID 59591112) is 1-but-1-en-2-ylaziridine.
What is the SMILES notation for 1-but-1-en-2-ylaziridine?
The canonical SMILES for 1-but-1-en-2-ylaziridine is C=C(CC)N1CC1.
What is the InChIKey of 1-but-1-en-2-ylaziridine?
The InChIKey is NFRWSXLFCOUFDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N/c1-3-6(2)7-4-5-7/h2-5H2,1H3.
What are the key properties of 1-but-1-en-2-ylaziridine?
1-but-1-en-2-ylaziridine has a molecular weight of 97.16 g/mol, XLogP of 1.23, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-1-en-2-ylaziridine is sourced from PubChem (CID 59591112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).