C28H46O5S2 — CID 59591528
decyl (3R,5R)-3,5-dihydroxy-6-[2-[2-(4-hydroxyphenyl)ethyl]-1,3-dithian-2-yl]hexanoate (PubChem CID 59591528) has the molecular formula C28H46O5S2 and a molecular weight of 526.81 g/mol. Its IUPAC name is decyl (3R,5R)-3,5-dihydroxy-6-[2-[2-(4-hydroxyphenyl)ethyl]-1,3-dithian-2-yl]hexanoate.
| Compound Name | decyl (3R,5R)-3,5-dihydroxy-6-[2-[2-(4-hydroxyphenyl)ethyl]-1,3-dithian-2-yl]hexanoate |
|---|---|
| PubChem CID | 59591528 |
| Molecular Formula | C28H46O5S2 |
| Molecular Weight | 526.81 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | decyl (3R,5R)-3,5-dihydroxy-6-[2-[2-(4-hydroxyphenyl)ethyl]-1,3-dithian-2-yl]hexanoate |
| SMILES | CCCCCCCCCCOC(=O)C[C@H](O)C[C@@H](O)CC1(CCc2ccc(O)cc2)SCCCS1 |
| InChI | InChI=1S/C28H46O5S2/c1-2-3-4-5-6-7-8-9-17-33-27(32)21-25(30)20-26(31)22-28(34-18-10-19-35-28)16-15-23-11-13-24(29)14-12-23/h11-14,25-26,29-31H,2-10,15-22H2,1H3/t25-,26-/m1/s1 |
| InChIKey | WKXYTMYJAAPUAG-CLJLJLNGSA-N |
| XLogP | 6.47 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.81 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|