About 4-(1-adamantyl)benzene-1,2,3-triol
4-(1-adamantyl)benzene-1,2,3-triol (PubChem CID 59591581) has the molecular formula C16H20O3
and a molecular weight of 260.33 g/mol. Its IUPAC name is 4-(1-adamantyl)benzene-1,2,3-triol.
Molecular Properties
| Compound Name | 4-(1-adamantyl)benzene-1,2,3-triol |
| PubChem CID | 59591581 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-(1-adamantyl)benzene-1,2,3-triol |
| SMILES | Oc1ccc(C23CC4CC(CC(C4)C2)C3)c(O)c1O |
| InChI | InChI=1S/C16H20O3/c17-13-2-1-12(14(18)15(13)19)16-6-9-3-10(7-16)5-11(4-9)8-16/h1-2,9-11,17-19H,3-8H2 |
| InChIKey | HHQFIRPSHKHEDY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-adamantyl)benzene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-adamantyl)benzene-1,2,3-triol?
The IUPAC name of 4-(1-adamantyl)benzene-1,2,3-triol (CID 59591581) is 4-(1-adamantyl)benzene-1,2,3-triol.
What is the SMILES notation for 4-(1-adamantyl)benzene-1,2,3-triol?
The canonical SMILES for 4-(1-adamantyl)benzene-1,2,3-triol is Oc1ccc(C23CC4CC(CC(C4)C2)C3)c(O)c1O.
What is the InChIKey of 4-(1-adamantyl)benzene-1,2,3-triol?
The InChIKey is HHQFIRPSHKHEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O3/c17-13-2-1-12(14(18)15(13)19)16-6-9-3-10(7-16)5-11(4-9)8-16/h1-2,9-11,17-19H,3-8H2.
What are the key properties of 4-(1-adamantyl)benzene-1,2,3-triol?
4-(1-adamantyl)benzene-1,2,3-triol has a molecular weight of 260.33 g/mol, XLogP of 3.27, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-adamantyl)benzene-1,2,3-triol is sourced from PubChem (CID 59591581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).