C18H19N5O3 — CID 59592709
4-[[1-methyl-4-(4-nitrophenyl)pyrazolo[3,4-b]pyridin-6-yl]methyl]morpholine (PubChem CID 59592709) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 4-[[1-methyl-4-(4-nitrophenyl)pyrazolo[3,4-b]pyridin-6-yl]methyl]morpholine.
| Compound Name | 4-[[1-methyl-4-(4-nitrophenyl)pyrazolo[3,4-b]pyridin-6-yl]methyl]morpholine |
|---|---|
| PubChem CID | 59592709 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 4-[[1-methyl-4-(4-nitrophenyl)pyrazolo[3,4-b]pyridin-6-yl]methyl]morpholine |
| SMILES | Cn1ncc2c(-c3ccc([N+](=O)[O-])cc3)cc(CN3CCOCC3)nc21 |
| InChI | InChI=1S/C18H19N5O3/c1-21-18-17(11-19-21)16(13-2-4-15(5-3-13)23(24)25)10-14(20-18)12-22-6-8-26-9-7-22/h2-5,10-11H,6-9,12H2,1H3 |
| InChIKey | CGHYCVDODCGPIG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|