C23H20N6OS — CID 59592927
2-(1H-indazol-4-yl)-4-morpholin-4-yl-N-phenylthieno[3,2-d]pyrimidin-6-amine (PubChem CID 59592927) has the molecular formula C23H20N6OS and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-(1H-indazol-4-yl)-4-morpholin-4-yl-N-phenylthieno[3,2-d]pyrimidin-6-amine.
| Compound Name | 2-(1H-indazol-4-yl)-4-morpholin-4-yl-N-phenylthieno[3,2-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 59592927 |
| Molecular Formula | C23H20N6OS |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2-(1H-indazol-4-yl)-4-morpholin-4-yl-N-phenylthieno[3,2-d]pyrimidin-6-amine |
| SMILES | c1ccc(Nc2cc3nc(-c4cccc5[nH]ncc45)nc(N4CCOCC4)c3s2)cc1 |
| InChI | InChI=1S/C23H20N6OS/c1-2-5-15(6-3-1)25-20-13-19-21(31-20)23(29-9-11-30-12-10-29)27-22(26-19)16-7-4-8-18-17(16)14-24-28-18/h1-8,13-14,25H,9-12H2,(H,24,28) |
| InChIKey | SMIDKUYBKUDRKB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |