C21H25N5O2 — CID 59593244
1-ethyl-4-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]-3-phenylimidazol-2-one (PubChem CID 59593244) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-ethyl-4-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]-3-phenylimidazol-2-one.
| Compound Name | 1-ethyl-4-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]-3-phenylimidazol-2-one |
|---|---|
| PubChem CID | 59593244 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-ethyl-4-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]-3-phenylimidazol-2-one |
| SMILES | CCn1cc(-c2ccnc(NC3CCC(O)CC3)n2)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C21H25N5O2/c1-2-25-14-19(26(21(25)28)16-6-4-3-5-7-16)18-12-13-22-20(24-18)23-15-8-10-17(27)11-9-15/h3-7,12-15,17,27H,2,8-11H2,1H3,(H,22,23,24) |
| InChIKey | CVRCZJBKLYMQGM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |