C18H23N5O — CID 59593316
N-butyl-3,5-dimethyl-4-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)pyrazole-1-carboxamide (PubChem CID 59593316) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is N-butyl-3,5-dimethyl-4-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)pyrazole-1-carboxamide.
| Compound Name | N-butyl-3,5-dimethyl-4-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 59593316 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-butyl-3,5-dimethyl-4-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)pyrazole-1-carboxamide |
| SMILES | CCCCNC(=O)n1nc(C)c(Cc2c[nH]c3ncccc23)c1C |
| InChI | InChI=1S/C18H23N5O/c1-4-5-8-20-18(24)23-13(3)16(12(2)22-23)10-14-11-21-17-15(14)7-6-9-19-17/h6-7,9,11H,4-5,8,10H2,1-3H3,(H,19,21)(H,20,24) |
| InChIKey | RDIPJKVURVGCPV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|