About 2-(6-oxoheptyl)guanidine
2-(6-oxoheptyl)guanidine (PubChem CID 59593585) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-(6-oxoheptyl)guanidine.
Molecular Properties
| Compound Name | 2-(6-oxoheptyl)guanidine |
| PubChem CID | 59593585 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 2-(6-oxoheptyl)guanidine |
| SMILES | CC(=O)CCCCCN=C(N)N |
| InChI | InChI=1S/C8H17N3O/c1-7(12)5-3-2-4-6-11-8(9)10/h2-6H2,1H3,(H4,9,10,11) |
| InChIKey | QSQZITWBCATKMY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-oxoheptyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-oxoheptyl)guanidine?
The IUPAC name of 2-(6-oxoheptyl)guanidine (CID 59593585) is 2-(6-oxoheptyl)guanidine.
What is the SMILES notation for 2-(6-oxoheptyl)guanidine?
The canonical SMILES for 2-(6-oxoheptyl)guanidine is CC(=O)CCCCCN=C(N)N.
What is the InChIKey of 2-(6-oxoheptyl)guanidine?
The InChIKey is QSQZITWBCATKMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O/c1-7(12)5-3-2-4-6-11-8(9)10/h2-6H2,1H3,(H4,9,10,11).
What are the key properties of 2-(6-oxoheptyl)guanidine?
2-(6-oxoheptyl)guanidine has a molecular weight of 171.24 g/mol, XLogP of 0.41, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-oxoheptyl)guanidine is sourced from PubChem (CID 59593585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).