About 2,4-dimethylazete
2,4-dimethylazete (PubChem CID 59593609) has the molecular formula C5H7N
and a molecular weight of 81.12 g/mol. Its IUPAC name is 2,4-dimethylazete.
Molecular Properties
| Compound Name | 2,4-dimethylazete |
| PubChem CID | 59593609 |
| Molecular Formula | C5H7N |
| Molecular Weight | 81.12 g/mol |
| Exact Mass | 81.06 |
| IUPAC Name | 2,4-dimethylazete |
| SMILES | CC1=CC(C)=N1 |
| InChI | InChI=1S/C5H7N/c1-4-3-5(2)6-4/h3H,1-2H3 |
| InChIKey | CFKSMORLXDDNRD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 81.12 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethylazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylazete?
The IUPAC name of 2,4-dimethylazete (CID 59593609) is 2,4-dimethylazete.
What is the SMILES notation for 2,4-dimethylazete?
The canonical SMILES for 2,4-dimethylazete is CC1=CC(C)=N1.
What is the InChIKey of 2,4-dimethylazete?
The InChIKey is CFKSMORLXDDNRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N/c1-4-3-5(2)6-4/h3H,1-2H3.
What are the key properties of 2,4-dimethylazete?
2,4-dimethylazete has a molecular weight of 81.12 g/mol, XLogP of 1.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylazete is sourced from PubChem (CID 59593609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).