C27H19N3O4 — CID 59593618
5-[3-(2,5-dioxopyrrol-1-yl)propyl]-12H-quinolino[2,3-b]acridine-7,14-dione (PubChem CID 59593618) has the molecular formula C27H19N3O4 and a molecular weight of 449.47 g/mol. Its IUPAC name is 5-[3-(2,5-dioxopyrrol-1-yl)propyl]-12H-quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5-[3-(2,5-dioxopyrrol-1-yl)propyl]-12H-quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 59593618 |
| Molecular Formula | C27H19N3O4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 5-[3-(2,5-dioxopyrrol-1-yl)propyl]-12H-quinolino[2,3-b]acridine-7,14-dione |
| SMILES | O=C1C=CC(=O)N1CCCn1c2ccccc2c(=O)c2cc3[nH]c4ccccc4c(=O)c3cc21 |
| InChI | InChI=1S/C27H19N3O4/c31-24-10-11-25(32)30(24)13-5-12-29-22-9-4-2-7-17(22)27(34)19-14-21-18(15-23(19)29)26(33)16-6-1-3-8-20(16)28-21/h1-4,6-11,14-15H,5,12-13H2,(H,28,33) |
| InChIKey | WDTWFGRPDSEWRE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|