C37H54O7 — CID 59593656
4-O-methyl 2-O-(oxiran-2-ylmethyl) 6-O-(8-tricyclo[5.2.1.02,6]decanyl) 3,5,7,9-tetramethyl-9-phenyldecane-2,4,6-tricarboxylate (PubChem CID 59593656) has the molecular formula C37H54O7 and a molecular weight of 610.83 g/mol. Its IUPAC name is 4-O-methyl 2-O-(oxiran-2-ylmethyl) 6-O-(8-tricyclo[5.2.1.02,6]decanyl) 3,5,7,9-tetramethyl-9-phenyldecane-2,4,6-tricarboxylate.
| Compound Name | 4-O-methyl 2-O-(oxiran-2-ylmethyl) 6-O-(8-tricyclo[5.2.1.02,6]decanyl) 3,5,7,9-tetramethyl-9-phenyldecane-2,4,6-tricarboxylate |
|---|---|
| PubChem CID | 59593656 |
| Molecular Formula | C37H54O7 |
| Molecular Weight | 610.83 g/mol |
| Exact Mass | 610.39 |
| IUPAC Name | 4-O-methyl 2-O-(oxiran-2-ylmethyl) 6-O-(8-tricyclo[5.2.1.02,6]decanyl) 3,5,7,9-tetramethyl-9-phenyldecane-2,4,6-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(CC(C)(C)c1ccccc1)C(=O)OC1CC2CC1C1CCCC21)C(=O)OC)C(=O)OCC1CO1 |
| InChI | InChI=1S/C37H54O7/c1-8-35(4,32(39)43-20-26-19-42-26)22-37(6,31(38)41-7)23-36(5,21-34(2,3)25-13-10-9-11-14-25)33(40)44-30-18-24-17-29(30)28-16-12-15-27(24)28/h9-11,13-14,24,26-30H,8,12,15-23H2,1-7H3 |
| InChIKey | OGFIRRWDYJHQFP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.83 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|