About 1,4-dihydroindazol-4-ide;yttrium
1,4-dihydroindazol-4-ide;yttrium (PubChem CID 59593792) has the molecular formula C7H5N2Y-
and a molecular weight of 206.04 g/mol. Its IUPAC name is 1,4-dihydroindazol-4-ide;yttrium.
Molecular Properties
| Compound Name | 1,4-dihydroindazol-4-ide;yttrium |
| PubChem CID | 59593792 |
| Molecular Formula | C7H5N2Y- |
| Molecular Weight | 206.04 g/mol |
| Exact Mass | 205.95 |
| IUPAC Name | 1,4-dihydroindazol-4-ide;yttrium |
| SMILES | [Y].[c-]1cccc2[nH]ncc12 |
| InChI | InChI=1S/C7H5N2.Y/c1-2-4-7-6(3-1)5-8-9-7;/h1-2,4-5H,(H,8,9);/q-1; |
| InChIKey | CQNRXZVRUMIWFN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.04 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dihydroindazol-4-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydroindazol-4-ide;yttrium?
The IUPAC name of 1,4-dihydroindazol-4-ide;yttrium (CID 59593792) is 1,4-dihydroindazol-4-ide;yttrium.
What is the SMILES notation for 1,4-dihydroindazol-4-ide;yttrium?
The canonical SMILES for 1,4-dihydroindazol-4-ide;yttrium is [Y].[c-]1cccc2[nH]ncc12.
What is the InChIKey of 1,4-dihydroindazol-4-ide;yttrium?
The InChIKey is CQNRXZVRUMIWFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N2.Y/c1-2-4-7-6(3-1)5-8-9-7;/h1-2,4-5H,(H,8,9);/q-1;.
What are the key properties of 1,4-dihydroindazol-4-ide;yttrium?
1,4-dihydroindazol-4-ide;yttrium has a molecular weight of 206.04 g/mol, XLogP of 1.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydroindazol-4-ide;yttrium is sourced from PubChem (CID 59593792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).