C57H54N6O15 — CID 59593956
5-prop-2-enoyloxypentyl 3-[5-[3,5-bis[3-[3-(5-prop-2-enoyloxypentoxycarbonyl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,2,4-oxadiazol-3-yl]benzoate (PubChem CID 59593956) has the molecular formula C57H54N6O15 and a molecular weight of 1063.09 g/mol. Its IUPAC name is 5-prop-2-enoyloxypentyl 3-[5-[3,5-bis[3-[3-(5-prop-2-enoyloxypentoxycarbonyl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,2,4-oxadiazol-3-yl]benzoate.
| Compound Name | 5-prop-2-enoyloxypentyl 3-[5-[3,5-bis[3-[3-(5-prop-2-enoyloxypentoxycarbonyl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,2,4-oxadiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 59593956 |
| Molecular Formula | C57H54N6O15 |
| Molecular Weight | 1063.09 g/mol |
| Exact Mass | 1062.36 |
| IUPAC Name | 5-prop-2-enoyloxypentyl 3-[5-[3,5-bis[3-[3-(5-prop-2-enoyloxypentoxycarbonyl)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]-1,2,4-oxadiazol-3-yl]benzoate |
| SMILES | C=CC(=O)OCCCCCOC(=O)c1cccc(-c2noc(-c3cc(-c4nc(-c5cccc(C(=O)OCCCCCOC(=O)C=C)c5)no4)cc(-c4nc(-c5cccc(C(=O)OCCCCCOC(=O)C=C)c5)no4)c3)n2)c1 |
| InChI | InChI=1S/C57H54N6O15/c1-4-46(64)70-25-10-7-13-28-73-55(67)40-22-16-19-37(31-40)49-58-52(76-61-49)43-34-44(53-59-50(62-77-53)38-20-17-23-41(32-38)56(68)74-29-14-8-11-26-71-47(65)5-2)36-45(35-43)54-60-51(63-78-54)39-21-18-24-42(33-39)57(69)75-30-15-9-12-27-72-48(66)6-3/h4-6,16-24,31-36H,1-3,7-15,25-30H2 |
| InChIKey | UXYKXQQXTBTQGZ-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 274.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.09 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|