C8H11F6N2O5S2- — CID 59594098
1,1,2,2,3,3-hexafluoro-3-(4-methylpiperazin-1-yl)sulfonylpropane-1-sulfonate (PubChem CID 59594098) has the molecular formula C8H11F6N2O5S2- and a molecular weight of 393.31 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-(4-methylpiperazin-1-yl)sulfonylpropane-1-sulfonate.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-(4-methylpiperazin-1-yl)sulfonylpropane-1-sulfonate |
|---|---|
| PubChem CID | 59594098 |
| Molecular Formula | C8H11F6N2O5S2- |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-(4-methylpiperazin-1-yl)sulfonylpropane-1-sulfonate |
| SMILES | CN1CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-])CC1 |
| InChI | InChI=1S/C8H12F6N2O5S2/c1-15-2-4-16(5-3-15)22(17,18)7(11,12)6(9,10)8(13,14)23(19,20)21/h2-5H2,1H3,(H,19,20,21)/p-1 |
| InChIKey | CZQBFXLWRWVUAU-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|