C13H19F6N2O5S2- — CID 59594104
1,1,2,2,3,3-hexafluoro-3-(4-piperidin-1-ylpiperidin-1-yl)sulfonylpropane-1-sulfonate (PubChem CID 59594104) has the molecular formula C13H19F6N2O5S2- and a molecular weight of 461.43 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-(4-piperidin-1-ylpiperidin-1-yl)sulfonylpropane-1-sulfonate.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-(4-piperidin-1-ylpiperidin-1-yl)sulfonylpropane-1-sulfonate |
|---|---|
| PubChem CID | 59594104 |
| Molecular Formula | C13H19F6N2O5S2- |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-(4-piperidin-1-ylpiperidin-1-yl)sulfonylpropane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C13H20F6N2O5S2/c14-11(15,13(18,19)28(24,25)26)12(16,17)27(22,23)21-8-4-10(5-9-21)20-6-2-1-3-7-20/h10H,1-9H2,(H,24,25,26)/p-1 |
| InChIKey | LZPMGEXOZBGXSI-UHFFFAOYSA-M |
| XLogP | 1.63 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|