About 2-methanidylpropane;tungsten
2-methanidylpropane;tungsten (PubChem CID 59594158) has the molecular formula C4H9W2-
and a molecular weight of 424.80 g/mol. Its IUPAC name is 2-methanidylpropane;tungsten.
Molecular Properties
| Compound Name | 2-methanidylpropane;tungsten |
| PubChem CID | 59594158 |
| Molecular Formula | C4H9W2- |
| Molecular Weight | 424.80 g/mol |
| Exact Mass | 424.97 |
| IUPAC Name | 2-methanidylpropane;tungsten |
| SMILES | [CH2-]C(C)C.[W].[W] |
| InChI | InChI=1S/C4H9.2W/c1-4(2)3;;/h4H,1H2,2-3H3;;/q-1;; |
| InChIKey | VTTQPWPEVSQBHS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.80 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidylpropane;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidylpropane;tungsten?
The IUPAC name of 2-methanidylpropane;tungsten (CID 59594158) is 2-methanidylpropane;tungsten.
What is the SMILES notation for 2-methanidylpropane;tungsten?
The canonical SMILES for 2-methanidylpropane;tungsten is [CH2-]C(C)C.[W].[W].
What is the InChIKey of 2-methanidylpropane;tungsten?
The InChIKey is VTTQPWPEVSQBHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.2W/c1-4(2)3;;/h4H,1H2,2-3H3;;/q-1;;.
What are the key properties of 2-methanidylpropane;tungsten?
2-methanidylpropane;tungsten has a molecular weight of 424.80 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidylpropane;tungsten is sourced from PubChem (CID 59594158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).