About 2-methanidylbutane;tungsten
2-methanidylbutane;tungsten (PubChem CID 59594159) has the molecular formula C5H11W5-
and a molecular weight of 990.34 g/mol. Its IUPAC name is 2-methanidylbutane;tungsten.
Molecular Properties
| Compound Name | 2-methanidylbutane;tungsten |
| PubChem CID | 59594159 |
| Molecular Formula | C5H11W5- |
| Molecular Weight | 990.34 g/mol |
| Exact Mass | 990.84 |
| IUPAC Name | 2-methanidylbutane;tungsten |
| SMILES | [CH2-]C(C)CC.[W].[W].[W].[W].[W] |
| InChI | InChI=1S/C5H11.5W/c1-4-5(2)3;;;;;/h5H,2,4H2,1,3H3;;;;;/q-1;;;;; |
| InChIKey | RPUBNQLQEJMINM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 990.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidylbutane;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidylbutane;tungsten?
The IUPAC name of 2-methanidylbutane;tungsten (CID 59594159) is 2-methanidylbutane;tungsten.
What is the SMILES notation for 2-methanidylbutane;tungsten?
The canonical SMILES for 2-methanidylbutane;tungsten is [CH2-]C(C)CC.[W].[W].[W].[W].[W].
What is the InChIKey of 2-methanidylbutane;tungsten?
The InChIKey is RPUBNQLQEJMINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11.5W/c1-4-5(2)3;;;;;/h5H,2,4H2,1,3H3;;;;;/q-1;;;;;.
What are the key properties of 2-methanidylbutane;tungsten?
2-methanidylbutane;tungsten has a molecular weight of 990.34 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidylbutane;tungsten is sourced from PubChem (CID 59594159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).