C26H26F6N4O3S — CID 59594675
N'-hydroxy-2-methoxy-4-[[2-[4-(trifluoromethyl)phenyl]-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide (PubChem CID 59594675) has the molecular formula C26H26F6N4O3S and a molecular weight of 588.57 g/mol. Its IUPAC name is N'-hydroxy-2-methoxy-4-[[2-[4-(trifluoromethyl)phenyl]-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-2-methoxy-4-[[2-[4-(trifluoromethyl)phenyl]-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 59594675 |
| Molecular Formula | C26H26F6N4O3S |
| Molecular Weight | 588.57 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | N'-hydroxy-2-methoxy-4-[[2-[4-(trifluoromethyl)phenyl]-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide |
| SMILES | COc1cc(OCc2sc(-c3ccc(C(F)(F)F)cc3)nc2CN2CCC(C(F)(F)F)CC2)ccc1/C(N)=N/O |
| InChI | InChI=1S/C26H26F6N4O3S/c1-38-21-12-18(6-7-19(21)23(33)35-37)39-14-22-20(13-36-10-8-17(9-11-36)26(30,31)32)34-24(40-22)15-2-4-16(5-3-15)25(27,28)29/h2-7,12,17,37H,8-11,13-14H2,1H3,(H2,33,35) |
| InChIKey | KVXRXSJPUHXBSW-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|