C26H24F8N4O3S — CID 59594677
2-(difluoromethoxy)-N'-hydroxy-4-[[2-[4-(trifluoromethyl)phenyl]-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide (PubChem CID 59594677) has the molecular formula C26H24F8N4O3S and a molecular weight of 624.55 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N'-hydroxy-4-[[2-[4-(trifluoromethyl)phenyl]-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide.
| Compound Name | 2-(difluoromethoxy)-N'-hydroxy-4-[[2-[4-(trifluoromethyl)phenyl]-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 59594677 |
| Molecular Formula | C26H24F8N4O3S |
| Molecular Weight | 624.55 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | 2-(difluoromethoxy)-N'-hydroxy-4-[[2-[4-(trifluoromethyl)phenyl]-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(OCc2sc(-c3ccc(C(F)(F)F)cc3)nc2CN2CCC(C(F)(F)F)CC2)cc1OC(F)F |
| InChI | InChI=1S/C26H24F8N4O3S/c27-24(28)41-20-11-17(5-6-18(20)22(35)37-39)40-13-21-19(12-38-9-7-16(8-10-38)26(32,33)34)36-23(42-21)14-1-3-15(4-2-14)25(29,30)31/h1-6,11,16,24,39H,7-10,12-13H2,(H2,35,37) |
| InChIKey | UFGNVSSMYJBLJM-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.55 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|