C27H24F10N4O3S — CID 59594698
5-fluoro-N'-hydroxy-2-(2,2,2-trifluoroethoxy)-4-[[2-[4-(trifluoromethyl)phenyl]-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide (PubChem CID 59594698) has the molecular formula C27H24F10N4O3S and a molecular weight of 674.56 g/mol. Its IUPAC name is 5-fluoro-N'-hydroxy-2-(2,2,2-trifluoroethoxy)-4-[[2-[4-(trifluoromethyl)phenyl]-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide.
| Compound Name | 5-fluoro-N'-hydroxy-2-(2,2,2-trifluoroethoxy)-4-[[2-[4-(trifluoromethyl)phenyl]-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 59594698 |
| Molecular Formula | C27H24F10N4O3S |
| Molecular Weight | 674.56 g/mol |
| Exact Mass | 674.14 |
| IUPAC Name | 5-fluoro-N'-hydroxy-2-(2,2,2-trifluoroethoxy)-4-[[2-[4-(trifluoromethyl)phenyl]-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide |
| SMILES | N/C(=N\O)c1cc(F)c(OCc2sc(-c3ccc(C(F)(F)F)cc3)nc2CN2CCC(C(F)(F)F)CC2)cc1OCC(F)(F)F |
| InChI | InChI=1S/C27H24F10N4O3S/c28-18-9-17(23(38)40-42)20(44-13-25(29,30)31)10-21(18)43-12-22-19(11-41-7-5-16(6-8-41)27(35,36)37)39-24(45-22)14-1-3-15(4-2-14)26(32,33)34/h1-4,9-10,16,42H,5-8,11-13H2,(H2,38,40) |
| InChIKey | IFCQAAOCRZYPEW-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.56 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|