C21H19ClF3N3O3 — CID 59594742
2-chloro-N'-hydroxy-4-[[4-methyl-2-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3-oxazol-5-yl]methoxy]benzenecarboximidamide (PubChem CID 59594742) has the molecular formula C21H19ClF3N3O3 and a molecular weight of 453.85 g/mol. Its IUPAC name is 2-chloro-N'-hydroxy-4-[[4-methyl-2-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3-oxazol-5-yl]methoxy]benzenecarboximidamide.
| Compound Name | 2-chloro-N'-hydroxy-4-[[4-methyl-2-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3-oxazol-5-yl]methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 59594742 |
| Molecular Formula | C21H19ClF3N3O3 |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-chloro-N'-hydroxy-4-[[4-methyl-2-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3-oxazol-5-yl]methoxy]benzenecarboximidamide |
| SMILES | Cc1nc(CCc2ccc(C(F)(F)F)cc2)oc1COc1ccc(/C(N)=N/O)c(Cl)c1 |
| InChI | InChI=1S/C21H19ClF3N3O3/c1-12-18(11-30-15-7-8-16(17(22)10-15)20(26)28-29)31-19(27-12)9-4-13-2-5-14(6-3-13)21(23,24)25/h2-3,5-8,10,29H,4,9,11H2,1H3,(H2,26,28) |
| InChIKey | USEMUFGQRPYOKX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|