About 1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine
1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine (PubChem CID 59595069) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine |
| PubChem CID | 59595069 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine |
| SMILES | COCCCn1ccc2cccnc21 |
| InChI | InChI=1S/C11H14N2O/c1-14-9-3-7-13-8-5-10-4-2-6-12-11(10)13/h2,4-6,8H,3,7,9H2,1H3 |
| InChIKey | LGHXYPRKCOUTPH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine?
The IUPAC name of 1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine (CID 59595069) is 1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine?
The canonical SMILES for 1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine is COCCCn1ccc2cccnc21.
What is the InChIKey of 1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine?
The InChIKey is LGHXYPRKCOUTPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-14-9-3-7-13-8-5-10-4-2-6-12-11(10)13/h2,4-6,8H,3,7,9H2,1H3.
What are the key properties of 1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine?
1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine has a molecular weight of 190.25 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxypropyl)pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 59595069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).