C26H29N2O2+ — CID 59595218
2-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylic acid (PubChem CID 59595218) has the molecular formula C26H29N2O2+ and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylic acid.
| Compound Name | 2-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 59595218 |
| Molecular Formula | C26H29N2O2+ |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylic acid |
| SMILES | C[N+]1=C(/C=C/c2cc3c4c(c2)CCCN4CCC3)C(C)(C)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C26H28N2O2/c1-26(2)21-16-20(25(29)30)9-10-22(21)27(3)23(26)11-8-17-14-18-6-4-12-28-13-5-7-19(15-17)24(18)28/h8-11,14-16H,4-7,12-13H2,1-3H3/p+1 |
| InChIKey | DBNRNHSKVIRILY-UHFFFAOYSA-O |
| XLogP | 4.80 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|