C26H29N2O4+ — CID 59595277
2-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-4,6-dihydroxy-1,3,3-trimethylindol-1-ium-5-carboxylic acid (PubChem CID 59595277) has the molecular formula C26H29N2O4+ and a molecular weight of 433.53 g/mol. Its IUPAC name is 2-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-4,6-dihydroxy-1,3,3-trimethylindol-1-ium-5-carboxylic acid.
| Compound Name | 2-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-4,6-dihydroxy-1,3,3-trimethylindol-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 59595277 |
| Molecular Formula | C26H29N2O4+ |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 2-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-4,6-dihydroxy-1,3,3-trimethylindol-1-ium-5-carboxylic acid |
| SMILES | C[N+]1=C(/C=C/c2cc3c4c(c2)CCCN4CCC3)C(C)(C)c2c1cc(O)c(C(=O)O)c2O |
| InChI | InChI=1S/C26H28N2O4/c1-26(2)20(27(3)18-14-19(29)21(25(31)32)24(30)22(18)26)9-8-15-12-16-6-4-10-28-11-5-7-17(13-15)23(16)28/h8-9,12-14H,4-7,10-11H2,1-3H3,(H2-,29,30,31,32)/p+1 |
| InChIKey | LSNDITFBBJJLEM-UHFFFAOYSA-O |
| XLogP | 4.21 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|