C26H25N5O4 — CID 59595300
2-[(3Z)-3-[[4-[[4-(diethylamino)phenyl]diazenyl]phenyl]methylidene]-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]acetic acid (PubChem CID 59595300) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is 2-[(3Z)-3-[[4-[[4-(diethylamino)phenyl]diazenyl]phenyl]methylidene]-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]acetic acid.
| Compound Name | 2-[(3Z)-3-[[4-[[4-(diethylamino)phenyl]diazenyl]phenyl]methylidene]-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 59595300 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-[(3Z)-3-[[4-[[4-(diethylamino)phenyl]diazenyl]phenyl]methylidene]-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]acetic acid |
| SMILES | [C-]#[N+]C1=C(C)/C(=C/c2ccc(/N=N/c3ccc(N(CC)CC)cc3)cc2)C(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C26H25N5O4/c1-5-30(6-2)21-13-11-20(12-14-21)29-28-19-9-7-18(8-10-19)15-22-17(3)24(27-4)26(35)31(25(22)34)16-23(32)33/h7-15H,5-6,16H2,1-3H3,(H,32,33)/b22-15-,29-28+ |
| InChIKey | DIMULUJDMWTDCE-HBRXQUJASA-N |
| XLogP | 4.98 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|