C3H7BrO — CID 59596021
3-bromo-1,1,2,2,3,3-hexadeuteriopropan-1-ol (PubChem CID 59596021) has the molecular formula C3H7BrO and a molecular weight of 145.03 g/mol. Its IUPAC name is 3-bromo-1,1,2,2,3,3-hexadeuteriopropan-1-ol.
| Compound Name | 3-bromo-1,1,2,2,3,3-hexadeuteriopropan-1-ol |
|---|---|
| PubChem CID | 59596021 |
| Molecular Formula | C3H7BrO |
| Molecular Weight | 145.03 g/mol |
| Exact Mass | 144.01 |
| IUPAC Name | 3-bromo-1,1,2,2,3,3-hexadeuteriopropan-1-ol |
| SMILES | [2H]C([2H])(O)C([2H])([2H])C([2H])([2H])Br |
| InChI | InChI=1S/C3H7BrO/c4-2-1-3-5/h5H,1-3H2/i1D2,2D2,3D2 |
| InChIKey | RQFUZUMFPRMVDX-NMFSSPJFSA-N |
| XLogP | 0.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.03 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|