C28H35N3O4 — CID 59596051
6-[2,3-dihydro-1,4-benzodioxin-6-yl-[4-(2-methoxyethylamino)piperidin-1-yl]methyl]-3-ethyl-1H-quinolin-2-one (PubChem CID 59596051) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is 6-[2,3-dihydro-1,4-benzodioxin-6-yl-[4-(2-methoxyethylamino)piperidin-1-yl]methyl]-3-ethyl-1H-quinolin-2-one.
| Compound Name | 6-[2,3-dihydro-1,4-benzodioxin-6-yl-[4-(2-methoxyethylamino)piperidin-1-yl]methyl]-3-ethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 59596051 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 6-[2,3-dihydro-1,4-benzodioxin-6-yl-[4-(2-methoxyethylamino)piperidin-1-yl]methyl]-3-ethyl-1H-quinolin-2-one |
| SMILES | CCc1cc2cc(C(c3ccc4c(c3)OCCO4)N3CCC(NCCOC)CC3)ccc2[nH]c1=O |
| InChI | InChI=1S/C28H35N3O4/c1-3-19-16-22-17-20(4-6-24(22)30-28(19)32)27(21-5-7-25-26(18-21)35-15-14-34-25)31-11-8-23(9-12-31)29-10-13-33-2/h4-7,16-18,23,27,29H,3,8-15H2,1-2H3,(H,30,32) |
| InChIKey | MPRUFLCYRCFACR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|