C18H23F3N6OS — CID 59596226
N-hydroxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)-N'-[3-[4-(trifluoromethyl)phenyl]propyl]piperazine-1-carboximidamide (PubChem CID 59596226) has the molecular formula C18H23F3N6OS and a molecular weight of 428.48 g/mol. Its IUPAC name is N-hydroxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)-N'-[3-[4-(trifluoromethyl)phenyl]propyl]piperazine-1-carboximidamide.
| Compound Name | N-hydroxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)-N'-[3-[4-(trifluoromethyl)phenyl]propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59596226 |
| Molecular Formula | C18H23F3N6OS |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-hydroxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)-N'-[3-[4-(trifluoromethyl)phenyl]propyl]piperazine-1-carboximidamide |
| SMILES | Cc1nsnc1N1CCN(/C(=N/CCCc2ccc(C(F)(F)F)cc2)NO)CC1 |
| InChI | InChI=1S/C18H23F3N6OS/c1-13-16(25-29-24-13)26-9-11-27(12-10-26)17(23-28)22-8-2-3-14-4-6-15(7-5-14)18(19,20)21/h4-7,28H,2-3,8-12H2,1H3,(H,22,23) |
| InChIKey | QWQPUIDMURZSAV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|