C20H29FN6OS — CID 59596228
N'-[3-(4-tert-butylphenyl)propyl]-4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-hydroxypiperazine-1-carboximidamide (PubChem CID 59596228) has the molecular formula C20H29FN6OS and a molecular weight of 420.56 g/mol. Its IUPAC name is N'-[3-(4-tert-butylphenyl)propyl]-4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-hydroxypiperazine-1-carboximidamide.
| Compound Name | N'-[3-(4-tert-butylphenyl)propyl]-4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-hydroxypiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59596228 |
| Molecular Formula | C20H29FN6OS |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N'-[3-(4-tert-butylphenyl)propyl]-4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-hydroxypiperazine-1-carboximidamide |
| SMILES | CC(C)(C)c1ccc(CCC/N=C(\NO)N2CCN(c3nsnc3F)CC2)cc1 |
| InChI | InChI=1S/C20H29FN6OS/c1-20(2,3)16-8-6-15(7-9-16)5-4-10-22-19(23-28)27-13-11-26(12-14-27)18-17(21)24-29-25-18/h6-9,28H,4-5,10-14H2,1-3H3,(H,22,23) |
| InChIKey | XIPTZMAUADQHLC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|