C14H18ClN5 — CID 59596323
2-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-1,2,5,6,7,8-hexahydroquinazolin-4-amine (PubChem CID 59596323) has the molecular formula C14H18ClN5 and a molecular weight of 291.79 g/mol. Its IUPAC name is 2-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-1,2,5,6,7,8-hexahydroquinazolin-4-amine.
| Compound Name | 2-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-1,2,5,6,7,8-hexahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 59596323 |
| Molecular Formula | C14H18ClN5 |
| Molecular Weight | 291.79 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-1,2,5,6,7,8-hexahydroquinazolin-4-amine |
| SMILES | ClC1N=C(Nc2cc(C3CC3)[nH]n2)C2=C(CCCC2)N1 |
| InChI | InChI=1S/C14H18ClN5/c15-14-16-10-4-2-1-3-9(10)13(18-14)17-12-7-11(19-20-12)8-5-6-8/h7-8,14,16H,1-6H2,(H2,17,18,19,20) |
| InChIKey | UDGLMKHMDNLBPA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|